C9H11BrMgO2 — CID 13401204
magnesium;1,4-dimethoxy-2-methylbenzene-5-ide;bromide (PubChem CID 13401204) has the molecular formula C9H11BrMgO2 and a molecular weight of 255.39 g/mol. Its IUPAC name is magnesium;1,4-dimethoxy-2-methylbenzene-5-ide;bromide.
| Compound Name | magnesium;1,4-dimethoxy-2-methylbenzene-5-ide;bromide |
|---|---|
| PubChem CID | 13401204 |
| Molecular Formula | C9H11BrMgO2 |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | magnesium;1,4-dimethoxy-2-methylbenzene-5-ide;bromide |
| SMILES | COc1[c-]cc(OC)c(C)c1.[Br-].[Mg+2] |
| InChI | InChI=1S/C9H11O2.BrH.Mg/c1-7-6-8(10-2)4-5-9(7)11-3;;/h5-6H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | CJUJGFQVEVPZRC-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|