About Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1)
Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1) (PubChem CID 12914311) has the molecular formula C9H11BrMgO
and a molecular weight of 239.39 g/mol. Its IUPAC name is magnesium;2-methoxy-1,3-dimethylbenzene-5-ide;bromide.
Molecular Properties
| Compound Name | Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1) |
| PubChem CID | 12914311 |
| Molecular Formula | C9H11BrMgO |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | magnesium;2-methoxy-1,3-dimethylbenzene-5-ide;bromide |
| SMILES | CC1=C(C(=C[C-]=C1)C)OC.[Mg+2].[Br-] |
| InChI | InChI=1S/C9H11O.BrH.Mg/c1-7-5-4-6-8(2)9(7)10-3;;/h5-6H,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | XSPAONKQJCLPAB-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 207 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1)?
The IUPAC name of Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1) (CID 12914311) is magnesium;2-methoxy-1,3-dimethylbenzene-5-ide;bromide.
What is the SMILES notation for Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1)?
The canonical SMILES for Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1) is CC1=C(C(=C[C-]=C1)C)OC.[Mg+2].[Br-].
What is the InChIKey of Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1)?
The InChIKey is XSPAONKQJCLPAB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11O.BrH.Mg/c1-7-5-4-6-8(2)9(7)10-3;;/h5-6H,1-3H3;1H;/q-1;;+2/p-1.
What are the key properties of Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1)?
Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1) has a molecular weight of 239.39 g/mol, XLogP of not available, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Magnesium bromide 4-methoxy-3,5-dimethylbenzen-1-ide (1/1/1) is sourced from PubChem (CID 12914311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).