C9H5F6LiO — CID 135082765
lithium 1-methoxy-3,5-bis(trifluoromethyl)benzene-6-ide (PubChem CID 135082765) has the molecular formula C9H5F6LiO and a molecular weight of 250.07 g/mol. Its IUPAC name is lithium 1-methoxy-3,5-bis(trifluoromethyl)benzene-6-ide.
| Compound Name | lithium 1-methoxy-3,5-bis(trifluoromethyl)benzene-6-ide |
|---|---|
| PubChem CID | 135082765 |
| Molecular Formula | C9H5F6LiO |
| Molecular Weight | 250.07 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | lithium 1-methoxy-3,5-bis(trifluoromethyl)benzene-6-ide |
| SMILES | COc1[c-]c(C(F)(F)F)cc(C(F)(F)F)c1.[Li+] |
| InChI | InChI=1S/C9H5F6O.Li/c1-16-7-3-5(8(10,11)12)2-6(4-7)9(13,14)15;/h2-3H,1H3;/q-1;+1 |
| InChIKey | YVCQCHNPKZWEET-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.07 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|