C11H10F6O2W — CID 59592265
carbanide;1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene-4-ide;tungsten(2+) (PubChem CID 59592265) has the molecular formula C11H10F6O2W and a molecular weight of 472.03 g/mol. Its IUPAC name is carbanide;1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene-4-ide;tungsten(2+).
| Compound Name | carbanide;1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene-4-ide;tungsten(2+) |
|---|---|
| PubChem CID | 59592265 |
| Molecular Formula | C11H10F6O2W |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | carbanide;1,5-dimethyl-2,3-bis(trifluoromethoxy)benzene-4-ide;tungsten(2+) |
| SMILES | Cc1[c-]c(OC(F)(F)F)c(OC(F)(F)F)c(C)c1.[CH3-].[W+2] |
| InChI | InChI=1S/C10H7F6O2.CH3.W/c1-5-3-6(2)8(18-10(14,15)16)7(4-5)17-9(11,12)13;;/h3H,1-2H3;1H3;/q2*-1;+2 |
| InChIKey | IXKZQSLZWUXFLK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|