C10H11F3OW — CID 59592335
carbanide;2,4-dimethyl-1-(trifluoromethoxy)benzene-5-ide;tungsten(2+) (PubChem CID 59592335) has the molecular formula C10H11F3OW and a molecular weight of 388.03 g/mol. Its IUPAC name is carbanide;2,4-dimethyl-1-(trifluoromethoxy)benzene-5-ide;tungsten(2+).
| Compound Name | carbanide;2,4-dimethyl-1-(trifluoromethoxy)benzene-5-ide;tungsten(2+) |
|---|---|
| PubChem CID | 59592335 |
| Molecular Formula | C10H11F3OW |
| Molecular Weight | 388.03 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | carbanide;2,4-dimethyl-1-(trifluoromethoxy)benzene-5-ide;tungsten(2+) |
| SMILES | Cc1[c-]cc(OC(F)(F)F)c(C)c1.[CH3-].[W+2] |
| InChI | InChI=1S/C9H8F3O.CH3.W/c1-6-3-4-8(7(2)5-6)13-9(10,11)12;;/h4-5H,1-2H3;1H3;/q2*-1;+2 |
| InChIKey | JBFNFONIGGGWDF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.03 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|