C10H9F4OY- — CID 59067430
2-fluoro-1,4,5-trimethyl-3-(trifluoromethoxy)benzene-6-ide;yttrium (PubChem CID 59067430) has the molecular formula C10H9F4OY- and a molecular weight of 310.08 g/mol. Its IUPAC name is 2-fluoro-1,4,5-trimethyl-3-(trifluoromethoxy)benzene-6-ide;yttrium.
| Compound Name | 2-fluoro-1,4,5-trimethyl-3-(trifluoromethoxy)benzene-6-ide;yttrium |
|---|---|
| PubChem CID | 59067430 |
| Molecular Formula | C10H9F4OY- |
| Molecular Weight | 310.08 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 2-fluoro-1,4,5-trimethyl-3-(trifluoromethoxy)benzene-6-ide;yttrium |
| SMILES | Cc1[c-]c(C)c(F)c(OC(F)(F)F)c1C.[Y] |
| InChI | InChI=1S/C10H9F4O.Y/c1-5-4-6(2)8(11)9(7(5)3)15-10(12,13)14;/h1-3H3;/q-1; |
| InChIKey | XELJTWFMSRUATK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.08 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|