C12H18F2O3 — CID 123937559
3-(difluoromethoxy)-2-methoxy-6-(methoxymethyl)octa-1,3,5-triene (PubChem CID 123937559) has the molecular formula C12H18F2O3 and a molecular weight of 248.27 g/mol. Its IUPAC name is 3-(difluoromethoxy)-2-methoxy-6-(methoxymethyl)octa-1,3,5-triene.
| Compound Name | 3-(difluoromethoxy)-2-methoxy-6-(methoxymethyl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 123937559 |
| Molecular Formula | C12H18F2O3 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(difluoromethoxy)-2-methoxy-6-(methoxymethyl)octa-1,3,5-triene |
| SMILES | C=C(OC)C(=CC=C(CC)COC)OC(F)F |
| InChI | InChI=1S/C12H18F2O3/c1-5-10(8-15-3)6-7-11(9(2)16-4)17-12(13)14/h6-7,12H,2,5,8H2,1,3-4H3 |
| InChIKey | JIBLUKXYDCUHAX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|