C14H20 — CID 142902876
1-[(1Z,3Z)-penta-1,3-dienyl]-2-[(E)-prop-1-enyl]cyclohexene (PubChem CID 142902876) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-[(1Z,3Z)-penta-1,3-dienyl]-2-[(E)-prop-1-enyl]cyclohexene.
| Compound Name | 1-[(1Z,3Z)-penta-1,3-dienyl]-2-[(E)-prop-1-enyl]cyclohexene |
|---|---|
| PubChem CID | 142902876 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-[(1Z,3Z)-penta-1,3-dienyl]-2-[(E)-prop-1-enyl]cyclohexene |
| SMILES | C/C=C\C=C/C1=C(/C=C/C)CCCC1 |
| InChI | InChI=1S/C14H20/c1-3-5-6-10-14-12-8-7-11-13(14)9-4-2/h3-6,9-10H,7-8,11-12H2,1-2H3/b5-3-,9-4+,10-6- |
| InChIKey | VNAOEQNGLNMONQ-CJBUATDDSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|