C8H11N — CID 145362003
1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]azirine (PubChem CID 145362003) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]azirine.
| Compound Name | 1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]azirine |
|---|---|
| PubChem CID | 145362003 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 1-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]azirine |
| SMILES | C/C=C\C=C/C1=CN1C |
| InChI | InChI=1S/C8H11N/c1-3-4-5-6-8-7-9(8)2/h3-7H,1-2H3/b4-3-,6-5- |
| InChIKey | XNEORNAPTLYFTI-OUPQRBNQSA-N |
| XLogP | 1.91 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|