C11H9F3 — CID 138978580
1,2,3-trifluoro-5-[(1E,3E)-penta-1,3-dienyl]benzene (PubChem CID 138978580) has the molecular formula C11H9F3 and a molecular weight of 198.19 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[(1E,3E)-penta-1,3-dienyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[(1E,3E)-penta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 138978580 |
| Molecular Formula | C11H9F3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1,2,3-trifluoro-5-[(1E,3E)-penta-1,3-dienyl]benzene |
| SMILES | C/C=C/C=C/c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H9F3/c1-2-3-4-5-8-6-9(12)11(14)10(13)7-8/h2-7H,1H3/b3-2+,5-4+ |
| InChIKey | JDXLWOIBBDOQDI-MQQKCMAXSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|