About (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine
(E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine (PubChem CID 103092004) has the molecular formula C11H12F3N
and a molecular weight of 215.22 g/mol. Its IUPAC name is (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine.
Molecular Properties
| Compound Name | (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine |
| PubChem CID | 103092004 |
| Molecular Formula | C11H12F3N |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine |
| SMILES | CNC(C)/C=C/c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H12F3N/c1-7(15-2)3-4-8-5-9(12)11(14)10(13)6-8/h3-7,15H,1-2H3/b4-3+ |
| InChIKey | XEFVKQISQMBSNB-ONEGZZNKSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine?
The IUPAC name of (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine (CID 103092004) is (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine.
What is the SMILES notation for (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine?
The canonical SMILES for (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine is CNC(C)/C=C/c1cc(F)c(F)c(F)c1.
What is the InChIKey of (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine?
The InChIKey is XEFVKQISQMBSNB-ONEGZZNKSA-N. The full InChI is InChI=1S/C11H12F3N/c1-7(15-2)3-4-8-5-9(12)11(14)10(13)6-8/h3-7,15H,1-2H3/b4-3+.
What are the key properties of (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine?
(E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine has a molecular weight of 215.22 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methyl-4-(3,4,5-trifluorophenyl)but-3-en-2-amine is sourced from PubChem (CID 103092004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).