C11H18BO2- — CID 123357960
deuterio-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)boranuide;ethane (PubChem CID 123357960) has the molecular formula C11H18BO2- and a molecular weight of 194.08 g/mol. Its IUPAC name is deuterio-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)boranuide;ethane.
| Compound Name | deuterio-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)boranuide;ethane |
|---|---|
| PubChem CID | 123357960 |
| Molecular Formula | C11H18BO2- |
| Molecular Weight | 194.08 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | deuterio-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)boranuide;ethane |
| SMILES | CC.[2H][BH-]=C1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C9H12BO2.C2H6/c10-7-8(11)5-3-1-2-4-6(5)9(7)12;1-2/h5-6H,1-4,10H2;1-2H3/q-1;/i10D; |
| InChIKey | BFZIWARZDOKNPP-GIZWGYPNSA-N |
| XLogP | 0.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.08 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|