C13H19NO — CID 143698493
8-ethenyl-7-[(Z)-prop-1-enyl]-3,4,4a,5,6,8a-hexahydro-2H-1,4-benzoxazine (PubChem CID 143698493) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 8-ethenyl-7-[(Z)-prop-1-enyl]-3,4,4a,5,6,8a-hexahydro-2H-1,4-benzoxazine.
| Compound Name | 8-ethenyl-7-[(Z)-prop-1-enyl]-3,4,4a,5,6,8a-hexahydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 143698493 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 8-ethenyl-7-[(Z)-prop-1-enyl]-3,4,4a,5,6,8a-hexahydro-2H-1,4-benzoxazine |
| SMILES | C=CC1=C(/C=C\C)CCC2NCCOC12 |
| InChI | InChI=1S/C13H19NO/c1-3-5-10-6-7-12-13(11(10)4-2)15-9-8-14-12/h3-5,12-14H,2,6-9H2,1H3/b5-3- |
| InChIKey | DEUFQEZGSPZYLB-HYXAFXHYSA-N |
| XLogP | 2.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |