C11H19N — CID 142040872
(2E)-2-[(Z)-but-2-enylidene]-N-methylcyclohexan-1-amine (PubChem CID 142040872) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-N-methylcyclohexan-1-amine.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 142040872 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-N-methylcyclohexan-1-amine |
| SMILES | C/C=C\C=C1/CCCCC1NC |
| InChI | InChI=1S/C11H19N/c1-3-4-7-10-8-5-6-9-11(10)12-2/h3-4,7,11-12H,5-6,8-9H2,1-2H3/b4-3-,10-7+ |
| InChIKey | ZFVBOHFAUUIPRT-HQGAUJLMSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |