C13H20 — CID 142010020
1-ethenyl-2-[(Z)-2-methylbut-1-enyl]cyclohexene (PubChem CID 142010020) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1-ethenyl-2-[(Z)-2-methylbut-1-enyl]cyclohexene.
| Compound Name | 1-ethenyl-2-[(Z)-2-methylbut-1-enyl]cyclohexene |
|---|---|
| PubChem CID | 142010020 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1-ethenyl-2-[(Z)-2-methylbut-1-enyl]cyclohexene |
| SMILES | C=CC1=C(/C=C(/C)CC)CCCC1 |
| InChI | InChI=1S/C13H20/c1-4-11(3)10-13-9-7-6-8-12(13)5-2/h5,10H,2,4,6-9H2,1,3H3/b11-10- |
| InChIKey | LRKHOUAXIDELMW-KHPPLWFESA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |