C8H12O — CID 142175224
(1S)-2,3-dimethylidenecyclohexan-1-ol (PubChem CID 142175224) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (1S)-2,3-dimethylidenecyclohexan-1-ol.
| Compound Name | (1S)-2,3-dimethylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 142175224 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (1S)-2,3-dimethylidenecyclohexan-1-ol |
| SMILES | C=C1CCC[C@H](O)C1=C |
| InChI | InChI=1S/C8H12O/c1-6-4-3-5-8(9)7(6)2/h8-9H,1-5H2/t8-/m0/s1 |
| InChIKey | VAWDQDAPJKTONK-QMMMGPOBSA-N |
| XLogP | 1.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |