C9H15N — CID 123498215
3-methyl-4,5-dimethylideneazepane (PubChem CID 123498215) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3-methyl-4,5-dimethylideneazepane.
| Compound Name | 3-methyl-4,5-dimethylideneazepane |
|---|---|
| PubChem CID | 123498215 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3-methyl-4,5-dimethylideneazepane |
| SMILES | C=C1CCNCC(C)C1=C |
| InChI | InChI=1S/C9H15N/c1-7-4-5-10-6-8(2)9(7)3/h8,10H,1,3-6H2,2H3 |
| InChIKey | JEJOKXJCDZCNLV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |