C19H24 — CID 100957909
4,12-dimethylidenehexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane (PubChem CID 100957909) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 4,12-dimethylidenehexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane.
| Compound Name | 4,12-dimethylidenehexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane |
|---|---|
| PubChem CID | 100957909 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 4,12-dimethylidenehexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane |
| SMILES | C=C1CC2CC1C1C3CC(C21)C1C2CC(=C)C(C2)C31 |
| InChI | InChI=1S/C19H24/c1-8-3-10-5-12(8)18-15-7-14(16(10)18)17-11-4-9(2)13(6-11)19(15)17/h10-19H,1-7H2 |
| InChIKey | KUIQEFPYLRHZRG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|