C11H16N2O2 — CID 64817600
3-cyclopropyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 64817600) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-cyclopropyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 3-cyclopropyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 64817600 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3-cyclopropyl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | O=C1NC2CCCCC2C(=O)N1C1CC1 |
| InChI | InChI=1S/C11H16N2O2/c14-10-8-3-1-2-4-9(8)12-11(15)13(10)7-5-6-7/h7-9H,1-6H2,(H,12,15) |
| InChIKey | QYFCSDPJDSHTNC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |