C29H42N2O4 — CID 97103381
(3aR,7aR)-2-[4-[[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]cyclohexyl]methyl]cyclohexyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 97103381) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is (3aR,7aR)-2-[4-[[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]cyclohexyl]methyl]cyclohexyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[4-[[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]cyclohexyl]methyl]cyclohexyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 97103381 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | (3aR,7aR)-2-[4-[[4-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]cyclohexyl]methyl]cyclohexyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CCCC[C@H]2C(=O)N1C1CCC(CC2CCC(N3C(=O)[C@@H]4CCCC[C@H]4C3=O)CC2)CC1 |
| InChI | InChI=1S/C29H42N2O4/c32-26-22-5-1-2-6-23(22)27(33)30(26)20-13-9-18(10-14-20)17-19-11-15-21(16-12-19)31-28(34)24-7-3-4-8-25(24)29(31)35/h18-25H,1-17H2/t18?,19?,20?,21?,22-,23-,24-,25+/m1/s1 |
| InChIKey | FZEBPAUKBBDVSK-RERRZEAQSA-N |
| XLogP | 4.84 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|