C19H16F3N3O5S — CID 162537993
[4-hydroxy-6-(4-nitrophenyl)-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-(4-methoxyphenyl)methanone (PubChem CID 162537993) has the molecular formula C19H16F3N3O5S and a molecular weight of 455.41 g/mol. Its IUPAC name is [4-hydroxy-6-(4-nitrophenyl)-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-hydroxy-6-(4-nitrophenyl)-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 162537993 |
| Molecular Formula | C19H16F3N3O5S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [4-hydroxy-6-(4-nitrophenyl)-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2C(c3ccc([N+](=O)[O-])cc3)NC(=S)NC2(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O5S/c1-30-13-8-4-11(5-9-13)16(26)14-15(10-2-6-12(7-3-10)25(28)29)23-17(31)24-18(14,27)19(20,21)22/h2-9,14-15,27H,1H3,(H2,23,24,31) |
| InChIKey | XPHUVMYWFUIZJZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|