C18H15F3N2O2S — CID 7579817
[(4S,5R,6S)-4-hydroxy-6-phenyl-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-phenylmethanone (PubChem CID 7579817) has the molecular formula C18H15F3N2O2S and a molecular weight of 380.39 g/mol. Its IUPAC name is [(4S,5R,6S)-4-hydroxy-6-phenyl-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-phenylmethanone.
| Compound Name | [(4S,5R,6S)-4-hydroxy-6-phenyl-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7579817 |
| Molecular Formula | C18H15F3N2O2S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [(4S,5R,6S)-4-hydroxy-6-phenyl-2-sulfanylidene-4-(trifluoromethyl)-1,3-diazinan-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](c2ccccc2)NC(=S)N[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C18H15F3N2O2S/c19-18(20,21)17(25)13(15(24)12-9-5-2-6-10-12)14(22-16(26)23-17)11-7-3-1-4-8-11/h1-10,13-14,25H,(H2,22,23,26)/t13-,14+,17-/m0/s1 |
| InChIKey | IIVSGLAGBKLNIF-VBQJREDUSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|