C18H15F3N2O3 — CID 6589710
(4S,5S,6R)-5-benzoyl-4-hydroxy-6-phenyl-4-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 6589710) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is (4S,5S,6R)-5-benzoyl-4-hydroxy-6-phenyl-4-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | (4S,5S,6R)-5-benzoyl-4-hydroxy-6-phenyl-4-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 6589710 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (4S,5S,6R)-5-benzoyl-4-hydroxy-6-phenyl-4-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2)[C@H](C(=O)c2ccccc2)[C@](O)(C(F)(F)F)N1 |
| InChI | InChI=1S/C18H15F3N2O3/c19-18(20,21)17(26)13(15(24)12-9-5-2-6-10-12)14(22-16(25)23-17)11-7-3-1-4-8-11/h1-10,13-14,26H,(H2,22,23,25)/t13-,14+,17+/m1/s1 |
| InChIKey | UOIWGJQFFMKHKC-KEYYUXOJSA-N |
| XLogP | 2.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |