C18H15F3N2O4 — CID 7160983
(4R,5R,6R)-5-benzoyl-4-hydroxy-6-(2-hydroxyphenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 7160983) has the molecular formula C18H15F3N2O4 and a molecular weight of 380.32 g/mol. Its IUPAC name is (4R,5R,6R)-5-benzoyl-4-hydroxy-6-(2-hydroxyphenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6R)-5-benzoyl-4-hydroxy-6-(2-hydroxyphenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 7160983 |
| Molecular Formula | C18H15F3N2O4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (4R,5R,6R)-5-benzoyl-4-hydroxy-6-(2-hydroxyphenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2O)[C@@H](C(=O)c2ccccc2)[C@@](O)(C(F)(F)F)N1 |
| InChI | InChI=1S/C18H15F3N2O4/c19-18(20,21)17(27)13(15(25)10-6-2-1-3-7-10)14(22-16(26)23-17)11-8-4-5-9-12(11)24/h1-9,13-14,24,27H,(H2,22,23,26)/t13-,14-,17+/m0/s1 |
| InChIKey | OTFWNMJGGXWYHG-GRDNDAEWSA-N |
| XLogP | 2.50 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|