C22H26N2O — CID 54586140
(1S,2S,4R,5R)-N-methoxy-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-imine (PubChem CID 54586140) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2S,4R,5R)-N-methoxy-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-imine.
| Compound Name | (1S,2S,4R,5R)-N-methoxy-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-imine |
|---|---|
| PubChem CID | 54586140 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1S,2S,4R,5R)-N-methoxy-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-imine |
| SMILES | CO/N=C1\[C@H]2CCC[C@@H]1[C@H](c1ccccc1)N(C)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H26N2O/c1-24-21(16-10-5-3-6-11-16)18-14-9-15-19(20(18)23-25-2)22(24)17-12-7-4-8-13-17/h3-8,10-13,18-19,21-22H,9,14-15H2,1-2H3/b23-20-/t18-,19+,21-,22+/m0/s1 |
| InChIKey | FOCXOVHRAHEWAM-UXIGCNRKSA-N |
| XLogP | 4.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|