C21H25N3 — CID 40540984
[(1S,2R,4R,5R)-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydrazine (PubChem CID 40540984) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is [(1S,2R,4R,5R)-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydrazine.
| Compound Name | [(1S,2R,4R,5R)-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydrazine |
|---|---|
| PubChem CID | 40540984 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | [(1S,2R,4R,5R)-3-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonan-9-ylidene]hydrazine |
| SMILES | CN1[C@@H](c2ccccc2)[C@@H]2CCC[C@@H](/C2=N/N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H25N3/c1-24-20(15-9-4-2-5-10-15)17-13-8-14-18(19(17)23-22)21(24)16-11-6-3-7-12-16/h2-7,9-12,17-18,20-21H,8,13-14,22H2,1H3/b23-19-/t17-,18+,20-,21-/m0/s1 |
| InChIKey | AZCIWMNOPWJILR-BREIVMRLSA-N |
| XLogP | 4.15 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|