C22H29NO2 — CID 51856452
1-adamantyl-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone (PubChem CID 51856452) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-adamantyl-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | 1-adamantyl-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 51856452 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 1-adamantyl-[(2R)-2-(4-methoxyphenyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc([C@H]2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-25-19-6-4-18(5-7-19)20-3-2-8-23(20)21(24)22-12-15-9-16(13-22)11-17(10-15)14-22/h4-7,15-17,20H,2-3,8-14H2,1H3/t15?,16?,17?,20-,22?/m1/s1 |
| InChIKey | RBSIGGDHBDKHKB-ILYDUKKLSA-N |
| XLogP | 4.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |