C26H36N2O3 — CID 18097569
N-[4-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]adamantane-1-carboxamide (PubChem CID 18097569) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[4-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 18097569 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-[4-[2-(4-methoxyphenyl)pyrrolidin-1-yl]-4-oxobutyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(C2CCCN2C(=O)CCCNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H36N2O3/c1-31-22-8-6-21(7-9-22)23-4-3-11-28(23)24(29)5-2-10-27-25(30)26-15-18-12-19(16-26)14-20(13-18)17-26/h6-9,18-20,23H,2-5,10-17H2,1H3,(H,27,30) |
| InChIKey | DQVDQRCDLWVRRH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|