C12H16N2O2 — CID 116982870
4-(4-methoxyphenyl)-1,3-dimethylimidazolidin-2-one (PubChem CID 116982870) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,3-dimethylimidazolidin-2-one.
| Compound Name | 4-(4-methoxyphenyl)-1,3-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 116982870 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,3-dimethylimidazolidin-2-one |
| SMILES | COc1ccc(C2CN(C)C(=O)N2C)cc1 |
| InChI | InChI=1S/C12H16N2O2/c1-13-8-11(14(2)12(13)15)9-4-6-10(16-3)7-5-9/h4-7,11H,8H2,1-3H3 |
| InChIKey | ZZCATTYTDXRZAN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |