C22H30N2O4 — CID 139216494
2-[(3R,5R)-4-(2-hydroxyethyl)-3,5-bis(4-methoxyphenyl)piperazin-1-yl]ethanol (PubChem CID 139216494) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[(3R,5R)-4-(2-hydroxyethyl)-3,5-bis(4-methoxyphenyl)piperazin-1-yl]ethanol.
| Compound Name | 2-[(3R,5R)-4-(2-hydroxyethyl)-3,5-bis(4-methoxyphenyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 139216494 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-[(3R,5R)-4-(2-hydroxyethyl)-3,5-bis(4-methoxyphenyl)piperazin-1-yl]ethanol |
| SMILES | COc1ccc([C@@H]2CN(CCO)C[C@@H](c3ccc(OC)cc3)N2CCO)cc1 |
| InChI | InChI=1S/C22H30N2O4/c1-27-19-7-3-17(4-8-19)21-15-23(11-13-25)16-22(24(21)12-14-26)18-5-9-20(28-2)10-6-18/h3-10,21-22,25-26H,11-16H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | WPZHUNPOBTYSIS-VXKWHMMOSA-N |
| XLogP | 2.09 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |