C21H23NO2 — CID 139076949
(2S,6S)-1-acetyl-3,3-dimethyl-2,6-diphenylpiperidin-4-one (PubChem CID 139076949) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2S,6S)-1-acetyl-3,3-dimethyl-2,6-diphenylpiperidin-4-one.
| Compound Name | (2S,6S)-1-acetyl-3,3-dimethyl-2,6-diphenylpiperidin-4-one |
|---|---|
| PubChem CID | 139076949 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2S,6S)-1-acetyl-3,3-dimethyl-2,6-diphenylpiperidin-4-one |
| SMILES | CC(=O)N1[C@@H](c2ccccc2)C(C)(C)C(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-15(23)22-18(16-10-6-4-7-11-16)14-19(24)21(2,3)20(22)17-12-8-5-9-13-17/h4-13,18,20H,14H2,1-3H3/t18-,20-/m0/s1 |
| InChIKey | GOJUOFMMDKRWMV-ICSRJNTNSA-N |
| XLogP | 4.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |