About [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate
[(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate (PubChem CID 10083311) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate.
Analyze [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate?
The IUPAC name of [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate (CID 10083311) is [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate.
What is the SMILES notation for [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate?
The canonical SMILES for [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate is CC(=O)OCN1C(=O)C(C)(C)[C@@H]1c1ccccc1.
What is the InChIKey of [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate?
The InChIKey is NTGFAFINANHDDU-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H17NO3/c1-10(16)18-9-15-12(14(2,3)13(15)17)11-7-5-4-6-8-11/h4-8,12H,9H2,1-3H3/t12-/m0/s1.
What are the key properties of [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate?
[(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate has a molecular weight of 247.29 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-3,3-dimethyl-2-oxo-4-phenylazetidin-1-yl]methyl acetate is sourced from PubChem (CID 10083311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).