C14H17N3O4 — CID 150439119
(carbamoylamino) (2S)-1-acetyl-5-phenylpyrrolidine-2-carboxylate (PubChem CID 150439119) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is (carbamoylamino) (2S)-1-acetyl-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | (carbamoylamino) (2S)-1-acetyl-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 150439119 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (carbamoylamino) (2S)-1-acetyl-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CC(=O)N1C(c2ccccc2)CC[C@H]1C(=O)ONC(N)=O |
| InChI | InChI=1S/C14H17N3O4/c1-9(18)17-11(10-5-3-2-4-6-10)7-8-12(17)13(19)21-16-14(15)20/h2-6,11-12H,7-8H2,1H3,(H3,15,16,20)/t11?,12-/m0/s1 |
| InChIKey | HLJVZEVBBYBPTJ-KIYNQFGBSA-N |
| XLogP | 0.87 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|