C21H23NO3 — CID 2945930
1,2-bis(4-methoxyphenyl)-2-azaspiro[3.4]octan-3-one (PubChem CID 2945930) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)-2-azaspiro[3.4]octan-3-one.
| Compound Name | 1,2-bis(4-methoxyphenyl)-2-azaspiro[3.4]octan-3-one |
|---|---|
| PubChem CID | 2945930 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)-2-azaspiro[3.4]octan-3-one |
| SMILES | COc1ccc(C2N(c3ccc(OC)cc3)C(=O)C23CCCC3)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-24-17-9-5-15(6-10-17)19-21(13-3-4-14-21)20(23)22(19)16-7-11-18(25-2)12-8-16/h5-12,19H,3-4,13-14H2,1-2H3 |
| InChIKey | KNCCXERJPCMRDH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |