C13H17Cl2NO — CID 10912704
3,3-dichloro-2-(4-methoxyphenyl)-1-propan-2-ylazetidine (PubChem CID 10912704) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is 3,3-dichloro-2-(4-methoxyphenyl)-1-propan-2-ylazetidine.
| Compound Name | 3,3-dichloro-2-(4-methoxyphenyl)-1-propan-2-ylazetidine |
|---|---|
| PubChem CID | 10912704 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3,3-dichloro-2-(4-methoxyphenyl)-1-propan-2-ylazetidine |
| SMILES | COc1ccc(C2N(C(C)C)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C13H17Cl2NO/c1-9(2)16-8-13(14,15)12(16)10-4-6-11(17-3)7-5-10/h4-7,9,12H,8H2,1-3H3 |
| InChIKey | XAFYTKMMMKEHDA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|