C16H13Cl2IO — CID 134413250
1-[2,2-dichloro-3-(4-iodophenyl)cyclopropyl]-4-methoxybenzene (PubChem CID 134413250) has the molecular formula C16H13Cl2IO and a molecular weight of 419.09 g/mol. Its IUPAC name is 1-[2,2-dichloro-3-(4-iodophenyl)cyclopropyl]-4-methoxybenzene.
| Compound Name | 1-[2,2-dichloro-3-(4-iodophenyl)cyclopropyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 134413250 |
| Molecular Formula | C16H13Cl2IO |
| Molecular Weight | 419.09 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | 1-[2,2-dichloro-3-(4-iodophenyl)cyclopropyl]-4-methoxybenzene |
| SMILES | COc1ccc(C2C(c3ccc(I)cc3)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H13Cl2IO/c1-20-13-8-4-11(5-9-13)15-14(16(15,17)18)10-2-6-12(19)7-3-10/h2-9,14-15H,1H3 |
| InChIKey | MMSILPGNNBXJRG-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.09 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|