C30H23FN2O4 — CID 6554715
(3R,3aS,6aS)-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 6554715) has the molecular formula C30H23FN2O4 and a molecular weight of 494.52 g/mol. Its IUPAC name is (3R,3aS,6aS)-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aS,6aS)-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 6554715 |
| Molecular Formula | C30H23FN2O4 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (3R,3aS,6aS)-5-(4-fluorophenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc([C@H]2N(c3ccccc3)O[C@@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@]32c2ccccc2)cc1 |
| InChI | InChI=1S/C30H23FN2O4/c1-36-25-18-12-20(13-19-25)26-30(21-8-4-2-5-9-21)27(37-33(26)24-10-6-3-7-11-24)28(34)32(29(30)35)23-16-14-22(31)15-17-23/h2-19,26-27H,1H3/t26-,27-,30+/m1/s1 |
| InChIKey | UXUOYKZOFGFALT-ZKKGZRQESA-N |
| XLogP | 5.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|