C30H24N2O3 — CID 4181416
5-(3-methylphenyl)-2,3,3a-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 4181416) has the molecular formula C30H24N2O3 and a molecular weight of 460.53 g/mol. Its IUPAC name is 5-(3-methylphenyl)-2,3,3a-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(3-methylphenyl)-2,3,3a-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 4181416 |
| Molecular Formula | C30H24N2O3 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 5-(3-methylphenyl)-2,3,3a-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1cccc(N2C(=O)C3ON(c4ccccc4)C(c4ccccc4)C3(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C30H24N2O3/c1-21-12-11-19-25(20-21)31-28(33)27-30(29(31)34,23-15-7-3-8-16-23)26(22-13-5-2-6-14-22)32(35-27)24-17-9-4-10-18-24/h2-20,26-27H,1H3 |
| InChIKey | DCXXICKXBOGJSU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|