C31H26N2O5 — CID 40927302
(3S,3aR,6aS)-5-(3-methoxyphenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 40927302) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is (3S,3aR,6aS)-5-(3-methoxyphenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aS)-5-(3-methoxyphenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 40927302 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | (3S,3aR,6aS)-5-(3-methoxyphenyl)-3-(4-methoxyphenyl)-2,3a-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc([C@@H]2N(c3ccccc3)O[C@@H]3C(=O)N(c4cccc(OC)c4)C(=O)[C@@]32c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2O5/c1-36-25-18-16-21(17-19-25)27-31(22-10-5-3-6-11-22)28(38-33(27)23-12-7-4-8-13-23)29(34)32(30(31)35)24-14-9-15-26(20-24)37-2/h3-20,27-28H,1-2H3/t27-,28+,31+/m0/s1 |
| InChIKey | AMQXICBZAUZORP-WTNLLYQRSA-N |
| XLogP | 5.08 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|