C29H21FN2O3 — CID 4640725
3-(4-fluorophenyl)-2,3a,5-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 4640725) has the molecular formula C29H21FN2O3 and a molecular weight of 464.50 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,3a,5-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(4-fluorophenyl)-2,3a,5-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 4640725 |
| Molecular Formula | C29H21FN2O3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3-(4-fluorophenyl)-2,3a,5-triphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2ON(c3ccccc3)C(c3ccc(F)cc3)C2(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C29H21FN2O3/c30-22-18-16-20(17-19-22)25-29(21-10-4-1-5-11-21)26(35-32(25)24-14-8-3-9-15-24)27(33)31(28(29)34)23-12-6-2-7-13-23/h1-19,25-26H |
| InChIKey | BRWWJDBGEXMDRA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|