C29H20FN3O5 — CID 3418660
5-(4-fluorophenyl)-3a-(4-nitrophenyl)-2,3-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3418660) has the molecular formula C29H20FN3O5 and a molecular weight of 509.49 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3a-(4-nitrophenyl)-2,3-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(4-fluorophenyl)-3a-(4-nitrophenyl)-2,3-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3418660 |
| Molecular Formula | C29H20FN3O5 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 5-(4-fluorophenyl)-3a-(4-nitrophenyl)-2,3-diphenyl-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2ON(c3ccccc3)C(c3ccccc3)C2(c2ccc([N+](=O)[O-])cc2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C29H20FN3O5/c30-21-13-17-22(18-14-21)31-27(34)26-29(28(31)35,20-11-15-24(16-12-20)33(36)37)25(19-7-3-1-4-8-19)32(38-26)23-9-5-2-6-10-23/h1-18,25-26H |
| InChIKey | WHDFYGFWWFTRDU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|