C15H14N2O3 — CID 729895
(4R,5R)-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one (PubChem CID 729895) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (4R,5R)-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one.
| Compound Name | (4R,5R)-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one |
|---|---|
| PubChem CID | 729895 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (4R,5R)-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one |
| SMILES | O=C1N[C@@](O)(c2ccccc2)[C@](O)(c2ccccc2)N1 |
| InChI | InChI=1S/C15H14N2O3/c18-13-16-14(19,11-7-3-1-4-8-11)15(20,17-13)12-9-5-2-6-10-12/h1-10,19-20H,(H2,16,17,18)/t14-,15-/m1/s1 |
| InChIKey | YYTLDVQKMDUHFX-HUUCEWRRSA-N |
| XLogP | 0.99 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |