C18H14O6 — CID 141285928
3-(2,2-diphenylacetyl)-3,4-dihydroxyoxolane-2,5-dione (PubChem CID 141285928) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-(2,2-diphenylacetyl)-3,4-dihydroxyoxolane-2,5-dione.
| Compound Name | 3-(2,2-diphenylacetyl)-3,4-dihydroxyoxolane-2,5-dione |
|---|---|
| PubChem CID | 141285928 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-(2,2-diphenylacetyl)-3,4-dihydroxyoxolane-2,5-dione |
| SMILES | O=C1OC(=O)C(O)(C(=O)C(c2ccccc2)c2ccccc2)C1O |
| InChI | InChI=1S/C18H14O6/c19-14(18(23)15(20)16(21)24-17(18)22)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,15,20,23H |
| InChIKey | KCUCLNAQKPEFQU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|