C21H25NO — CID 7909419
N-[(1S,2R)-2-methylcyclohexyl]-2,2-diphenylacetamide (PubChem CID 7909419) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-2,2-diphenylacetamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 7909419 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-2,2-diphenylacetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO/c1-16-10-8-9-15-19(16)22-21(23)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-7,11-14,16,19-20H,8-10,15H2,1H3,(H,22,23)/t16-,19+/m1/s1 |
| InChIKey | RMZNOEVUDYPOSF-APWZRJJASA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |