C23H29N3O2 — CID 9372400
2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 9372400) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 9372400 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-[(E)-(1-amino-2,2-diphenylethylidene)amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)CO/N=C(/N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O2/c1-17-10-8-9-15-20(17)25-21(27)16-28-26-23(24)22(18-11-4-2-5-12-18)19-13-6-3-7-14-19/h2-7,11-14,17,20,22H,8-10,15-16H2,1H3,(H2,24,26)(H,25,27)/t17-,20-/m1/s1 |
| InChIKey | AYXVXXGIJSLRIO-YLJYHZDGSA-N |
| XLogP | 3.80 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|