C18H34N4O2 — CID 126817139
2-[[1-amino-2-(2,6-dimethylpiperidin-1-yl)ethylidene]amino]oxy-N-(2-methylcyclohexyl)acetamide (PubChem CID 126817139) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-[[1-amino-2-(2,6-dimethylpiperidin-1-yl)ethylidene]amino]oxy-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[[1-amino-2-(2,6-dimethylpiperidin-1-yl)ethylidene]amino]oxy-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 126817139 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 2-[[1-amino-2-(2,6-dimethylpiperidin-1-yl)ethylidene]amino]oxy-N-(2-methylcyclohexyl)acetamide |
| SMILES | CC1CCCCC1NC(=O)CON=C(N)CN1C(C)CCCC1C |
| InChI | InChI=1S/C18H34N4O2/c1-13-7-4-5-10-16(13)20-18(23)12-24-21-17(19)11-22-14(2)8-6-9-15(22)3/h13-16H,4-12H2,1-3H3,(H2,19,21)(H,20,23) |
| InChIKey | DBKVBVWKMFISSP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|