C9H16N2O2 — CID 124605602
N'-[(1R,2S)-2-methylcyclohexyl]oxamide (PubChem CID 124605602) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N'-[(1R,2S)-2-methylcyclohexyl]oxamide.
| Compound Name | N'-[(1R,2S)-2-methylcyclohexyl]oxamide |
|---|---|
| PubChem CID | 124605602 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N'-[(1R,2S)-2-methylcyclohexyl]oxamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)C(N)=O |
| InChI | InChI=1S/C9H16N2O2/c1-6-4-2-3-5-7(6)11-9(13)8(10)12/h6-7H,2-5H2,1H3,(H2,10,12)(H,11,13)/t6-,7+/m0/s1 |
| InChIKey | XNUXJNOUJDNCQZ-NKWVEPMBSA-N |
| XLogP | 0.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|