C8H16N2O — CID 3345444
(2-methylcyclohexyl)urea (PubChem CID 3345444) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (2-methylcyclohexyl)urea.
| Compound Name | (2-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 3345444 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (2-methylcyclohexyl)urea |
| SMILES | CC1CCCCC1NC(N)=O |
| InChI | InChI=1S/C8H16N2O/c1-6-4-2-3-5-7(6)10-8(9)11/h6-7H,2-5H2,1H3,(H3,9,10,11) |
| InChIKey | GDWADZHNEJCBKQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |