C14H27N3O2 — CID 11938459
6-(carbamoylamino)-N-[(1R,2S)-2-methylcyclohexyl]hexanamide (PubChem CID 11938459) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 6-(carbamoylamino)-N-[(1R,2S)-2-methylcyclohexyl]hexanamide.
| Compound Name | 6-(carbamoylamino)-N-[(1R,2S)-2-methylcyclohexyl]hexanamide |
|---|---|
| PubChem CID | 11938459 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 6-(carbamoylamino)-N-[(1R,2S)-2-methylcyclohexyl]hexanamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)CCCCCNC(N)=O |
| InChI | InChI=1S/C14H27N3O2/c1-11-7-4-5-8-12(11)17-13(18)9-3-2-6-10-16-14(15)19/h11-12H,2-10H2,1H3,(H,17,18)(H3,15,16,19)/t11-,12+/m0/s1 |
| InChIKey | MNMFKTUHBKYJFK-NWDGAFQWSA-N |
| XLogP | 1.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|