C20H31N5O2 — CID 52534598
2-[(Z)-[amino-(2-piperidin-1-yl-3-pyridinyl)methylidene]amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 52534598) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[(Z)-[amino-(2-piperidin-1-yl-3-pyridinyl)methylidene]amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[(Z)-[amino-(2-piperidin-1-yl-3-pyridinyl)methylidene]amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 52534598 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 2-[(Z)-[amino-(2-piperidin-1-yl-3-pyridinyl)methylidene]amino]oxy-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)CO/N=C(\N)c1cccnc1N1CCCCC1 |
| InChI | InChI=1S/C20H31N5O2/c1-15-8-3-4-10-17(15)23-18(26)14-27-24-19(21)16-9-7-11-22-20(16)25-12-5-2-6-13-25/h7,9,11,15,17H,2-6,8,10,12-14H2,1H3,(H2,21,24)(H,23,26)/t15-,17-/m1/s1 |
| InChIKey | WERMIBOJTGBQGF-NVXWUHKLSA-N |
| XLogP | 2.40 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|